C25H27NO7 — CID 4697109
4-hydroxy-1-(2-methoxyethyl)-3-(3-phenylprop-2-enoyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4697109) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is 4-hydroxy-1-(2-methoxyethyl)-3-(3-phenylprop-2-enoyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(2-methoxyethyl)-3-(3-phenylprop-2-enoyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4697109 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 4-hydroxy-1-(2-methoxyethyl)-3-(3-phenylprop-2-enoyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one |
| SMILES | COCCN1C(=O)C(O)=C(C(=O)C=Cc2ccccc2)C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H27NO7/c1-30-13-12-26-22(17-14-19(31-2)24(33-4)20(15-17)32-3)21(23(28)25(26)29)18(27)11-10-16-8-6-5-7-9-16/h5-11,14-15,22,28H,12-13H2,1-4H3 |
| InChIKey | LEDGYZHACXKRQS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|