C27H25NO7 — CID 4697421
1-(furan-2-ylmethyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4697421) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-(furan-2-ylmethyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4697421 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 1-(furan-2-ylmethyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one |
| SMILES | COc1cc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2Cc2ccco2)cc(OC)c1OC |
| InChI | InChI=1S/C27H25NO7/c1-32-21-14-18(15-22(33-2)26(21)34-3)24-23(20(29)12-11-17-8-5-4-6-9-17)25(30)27(31)28(24)16-19-10-7-13-35-19/h4-15,24,30H,16H2,1-3H3 |
| InChIKey | NAYGKBJKCFYQGN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|