C29H29NO5 — CID 6190176
1-(furan-2-ylmethyl)-4-hydroxy-2-(4-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6190176) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-4-hydroxy-2-(4-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 1-(furan-2-ylmethyl)-4-hydroxy-2-(4-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6190176 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-(furan-2-ylmethyl)-4-hydroxy-2-(4-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C29H29NO5/c1-2-3-7-18-34-23-15-13-22(14-16-23)27-26(25(31)17-12-21-9-5-4-6-10-21)28(32)29(33)30(27)20-24-11-8-19-35-24/h4-6,8-17,19,27,32H,2-3,7,18,20H2,1H3/b17-12+ |
| InChIKey | ACDZHLNONHBGMC-SFQUDFHCSA-N |
| XLogP | 6.03 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|