C29H31N3O4 — CID 4697474
2-(4-butoxyphenyl)-4-hydroxy-1-(3-imidazol-1-ylpropyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4697474) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-hydroxy-1-(3-imidazol-1-ylpropyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxyphenyl)-4-hydroxy-1-(3-imidazol-1-ylpropyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4697474 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-hydroxy-1-(3-imidazol-1-ylpropyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2CCCn2ccnc2)cc1 |
| InChI | InChI=1S/C29H31N3O4/c1-2-3-20-36-24-13-11-23(12-14-24)27-26(25(33)15-10-22-8-5-4-6-9-22)28(34)29(35)32(27)18-7-17-31-19-16-30-21-31/h4-6,8-16,19,21,27,34H,2-3,7,17-18,20H2,1H3 |
| InChIKey | LEORGGFXVNOEKS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|