C28H28N2O4S — CID 6189027
2-(4-hexoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one (PubChem CID 6189027) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-(4-hexoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-hexoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189027 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-(4-hexoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one |
| SMILES | CCCCCCOc1ccc(C2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2c2nccs2)cc1 |
| InChI | InChI=1S/C28H28N2O4S/c1-2-3-4-8-18-34-22-14-12-21(13-15-22)25-24(23(31)16-11-20-9-6-5-7-10-20)26(32)27(33)30(25)28-29-17-19-35-28/h5-7,9-17,19,25,32H,2-4,8,18H2,1H3/b16-11+ |
| InChIKey | OJSDNGHUGHCSDY-LFIBNONCSA-N |
| XLogP | 6.28 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|