C37H33N3O4S2 — CID 6189462
4-hydroxy-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(4-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189462) has the molecular formula C37H33N3O4S2 and a molecular weight of 647.82 g/mol. Its IUPAC name is 4-hydroxy-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(4-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(4-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189462 |
| Molecular Formula | C37H33N3O4S2 |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.19 |
| IUPAC Name | 4-hydroxy-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(4-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2c2nnc(SCc3cccc4ccccc34)s2)cc1 |
| InChI | InChI=1S/C37H33N3O4S2/c1-2-3-9-23-44-29-20-18-27(19-21-29)33-32(31(41)22-17-25-11-5-4-6-12-25)34(42)35(43)40(33)36-38-39-37(46-36)45-24-28-15-10-14-26-13-7-8-16-30(26)28/h4-8,10-22,33,42H,2-3,9,23-24H2,1H3/b22-17+ |
| InChIKey | RQXIINRGSTVXHS-OQKWZONESA-N |
| XLogP | 8.74 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|