C37H33N3O5S2 — CID 6189460
2-(4-butoxy-3-methoxyphenyl)-4-hydroxy-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189460) has the molecular formula C37H33N3O5S2 and a molecular weight of 663.82 g/mol. Its IUPAC name is 2-(4-butoxy-3-methoxyphenyl)-4-hydroxy-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-methoxyphenyl)-4-hydroxy-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189460 |
| Molecular Formula | C37H33N3O5S2 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.19 |
| IUPAC Name | 2-(4-butoxy-3-methoxyphenyl)-4-hydroxy-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2c2nnc(SCc3cccc4ccccc34)s2)cc1OC |
| InChI | InChI=1S/C37H33N3O5S2/c1-3-4-21-45-30-20-18-26(22-31(30)44-2)33-32(29(41)19-17-24-11-6-5-7-12-24)34(42)35(43)40(33)36-38-39-37(47-36)46-23-27-15-10-14-25-13-8-9-16-28(25)27/h5-20,22,33,42H,3-4,21,23H2,1-2H3/b19-17+ |
| InChIKey | LFFQLBQFAUAARV-HTXNQAPBSA-N |
| XLogP | 8.35 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|