C33H30ClN3O5S2 — CID 6189257
2-(4-butoxy-3-methoxyphenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189257) has the molecular formula C33H30ClN3O5S2 and a molecular weight of 648.21 g/mol. Its IUPAC name is 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189257 |
| Molecular Formula | C33H30ClN3O5S2 |
| Molecular Weight | 648.21 g/mol |
| Exact Mass | 647.13 |
| IUPAC Name | 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3)s2)cc1OC |
| InChI | InChI=1S/C33H30ClN3O5S2/c1-3-4-18-42-26-17-13-23(19-27(26)41-2)29-28(25(38)16-12-21-8-6-5-7-9-21)30(39)31(40)37(29)32-35-36-33(44-32)43-20-22-10-14-24(34)15-11-22/h5-17,19,29,39H,3-4,18,20H2,1-2H3/b16-12+ |
| InChIKey | SDFCVPQYNAIGQX-FOWTUZBSSA-N |
| XLogP | 7.85 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.21 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|