C31H26ClN3O4S2 — CID 4696521
1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4696521) has the molecular formula C31H26ClN3O4S2 and a molecular weight of 604.15 g/mol. Its IUPAC name is 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696521 |
| Molecular Formula | C31H26ClN3O4S2 |
| Molecular Weight | 604.15 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCCOc1cccc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3)s2)c1 |
| InChI | InChI=1S/C31H26ClN3O4S2/c1-2-17-39-24-10-6-9-22(18-24)27-26(25(36)16-13-20-7-4-3-5-8-20)28(37)29(38)35(27)30-33-34-31(41-30)40-19-21-11-14-23(32)15-12-21/h3-16,18,27,37H,2,17,19H2,1H3 |
| InChIKey | KJKBBGQAIZGXIK-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.15 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|