C32H27N3O4S2 — CID 4696420
4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-phenylprop-2-enoyl)-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4696420) has the molecular formula C32H27N3O4S2 and a molecular weight of 581.72 g/mol. Its IUPAC name is 4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-phenylprop-2-enoyl)-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-phenylprop-2-enoyl)-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696420 |
| Molecular Formula | C32H27N3O4S2 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | 4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-phenylprop-2-enoyl)-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
| SMILES | C=CCOc1cccc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2c2nnc(SCc3ccc(C)cc3)s2)c1 |
| InChI | InChI=1S/C32H27N3O4S2/c1-3-18-39-25-11-7-10-24(19-25)28-27(26(36)17-16-22-8-5-4-6-9-22)29(37)30(38)35(28)31-33-34-32(41-31)40-20-23-14-12-21(2)13-15-23/h3-17,19,28,37H,1,18,20H2,2H3 |
| InChIKey | DFNPUYPKVUFQES-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|