C29H23N3O3S2 — CID 6189129
4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenyl-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189129) has the molecular formula C29H23N3O3S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is 4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenyl-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenyl-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189129 |
| Molecular Formula | C29H23N3O3S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenyl-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | Cc1ccc(CSc2nnc(N3C(=O)C(O)=C(C(=O)/C=C/c4ccccc4)C3c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C29H23N3O3S2/c1-19-12-14-21(15-13-19)18-36-29-31-30-28(37-29)32-25(22-10-6-3-7-11-22)24(26(34)27(32)35)23(33)17-16-20-8-4-2-5-9-20/h2-17,25,34H,18H2,1H3/b17-16+ |
| InChIKey | MSEIOQIUUBRFIG-WUKNDPDISA-N |
| XLogP | 6.32 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|