C27H20N4O3S2 — CID 4696353
1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-pyridin-3-yl-2H-pyrrol-5-one (PubChem CID 4696353) has the molecular formula C27H20N4O3S2 and a molecular weight of 512.62 g/mol. Its IUPAC name is 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-pyridin-3-yl-2H-pyrrol-5-one.
| Compound Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-pyridin-3-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696353 |
| Molecular Formula | C27H20N4O3S2 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-pyridin-3-yl-2H-pyrrol-5-one |
| SMILES | O=C(C=Cc1ccccc1)C1=C(O)C(=O)N(c2nnc(SCc3ccccc3)s2)C1c1cccnc1 |
| InChI | InChI=1S/C27H20N4O3S2/c32-21(14-13-18-8-3-1-4-9-18)22-23(20-12-7-15-28-16-20)31(25(34)24(22)33)26-29-30-27(36-26)35-17-19-10-5-2-6-11-19/h1-16,23,33H,17H2 |
| InChIKey | WHUWIGDKKJGRCR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|