C28H20FN3O4S2 — CID 4696545
1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(4-hydroxyphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4696545) has the molecular formula C28H20FN3O4S2 and a molecular weight of 545.62 g/mol. Its IUPAC name is 1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(4-hydroxyphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(4-hydroxyphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696545 |
| Molecular Formula | C28H20FN3O4S2 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(4-hydroxyphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | O=C(C=Cc1ccccc1)C1=C(O)C(=O)N(c2nnc(SCc3ccccc3F)s2)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C28H20FN3O4S2/c29-21-9-5-4-8-19(21)16-37-28-31-30-27(38-28)32-24(18-11-13-20(33)14-12-18)23(25(35)26(32)36)22(34)15-10-17-6-2-1-3-7-17/h1-15,24,33,35H,16H2 |
| InChIKey | BNWIANPZSSRNEI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|