C28H17Cl4N3O3S2 — CID 6189389
2-(3,4-dichlorophenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189389) has the molecular formula C28H17Cl4N3O3S2 and a molecular weight of 649.41 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 2-(3,4-dichlorophenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189389 |
| Molecular Formula | C28H17Cl4N3O3S2 |
| Molecular Weight | 649.41 g/mol |
| Exact Mass | 646.95 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | O=C(/C=C/c1ccccc1)C1=C(O)C(=O)N(c2nnc(SCc3ccc(Cl)cc3Cl)s2)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H17Cl4N3O3S2/c29-18-9-7-17(20(31)13-18)14-39-28-34-33-27(40-28)35-24(16-8-10-19(30)21(32)12-16)23(25(37)26(35)38)22(36)11-6-15-4-2-1-3-5-15/h1-13,24,37H,14H2/b11-6+ |
| InChIKey | ZTUSMWDLSDDQMS-IZZDOVSWSA-N |
| XLogP | 8.63 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.41 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|