C30H21Cl2N3O5S2 — CID 4696670
methyl 4-[1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-2-yl]benzoate (PubChem CID 4696670) has the molecular formula C30H21Cl2N3O5S2 and a molecular weight of 638.55 g/mol. Its IUPAC name is methyl 4-[1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-2-yl]benzoate.
| Compound Name | methyl 4-[1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 4696670 |
| Molecular Formula | C30H21Cl2N3O5S2 |
| Molecular Weight | 638.55 g/mol |
| Exact Mass | 637.03 |
| IUPAC Name | methyl 4-[1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3Cl)s2)cc1 |
| InChI | InChI=1S/C30H21Cl2N3O5S2/c1-40-28(39)19-10-8-18(9-11-19)25-24(23(36)14-7-17-5-3-2-4-6-17)26(37)27(38)35(25)29-33-34-30(42-29)41-16-20-12-13-21(31)15-22(20)32/h2-15,25,37H,16H2,1H3 |
| InChIKey | RTKQQWIQSAFZEQ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.55 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|