C31H23Cl2N3O4S2 — CID 4696661
1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4696661) has the molecular formula C31H23Cl2N3O4S2 and a molecular weight of 636.58 g/mol. Its IUPAC name is 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696661 |
| Molecular Formula | C31H23Cl2N3O4S2 |
| Molecular Weight | 636.58 g/mol |
| Exact Mass | 635.05 |
| IUPAC Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
| SMILES | C=CCOc1ccc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3Cl)s2)cc1 |
| InChI | InChI=1S/C31H23Cl2N3O4S2/c1-2-16-40-23-13-10-20(11-14-23)27-26(25(37)15-8-19-6-4-3-5-7-19)28(38)29(39)36(27)30-34-35-31(42-30)41-18-21-9-12-22(32)17-24(21)33/h2-15,17,27,38H,1,16,18H2 |
| InChIKey | NKCBFINCFKINKP-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|