C35H27N3O4S2 — CID 6189118
1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-phenylmethoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189118) has the molecular formula C35H27N3O4S2 and a molecular weight of 617.75 g/mol. Its IUPAC name is 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-phenylmethoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-phenylmethoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189118 |
| Molecular Formula | C35H27N3O4S2 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.14 |
| IUPAC Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-phenylmethoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | O=C(/C=C/c1ccccc1)C1=C(O)C(=O)N(c2nnc(SCc3ccccc3)s2)C1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C35H27N3O4S2/c39-29(20-19-24-11-4-1-5-12-24)30-31(27-17-10-18-28(21-27)42-22-25-13-6-2-7-14-25)38(33(41)32(30)40)34-36-37-35(44-34)43-23-26-15-8-3-9-16-26/h1-21,31,40H,22-23H2/b20-19+ |
| InChIKey | VAWCSYLGOWXDNX-FMQUCBEESA-N |
| XLogP | 7.59 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|