C28H19FN4O5S2 — CID 4696590
1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(3-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4696590) has the molecular formula C28H19FN4O5S2 and a molecular weight of 574.62 g/mol. Its IUPAC name is 1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(3-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(3-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696590 |
| Molecular Formula | C28H19FN4O5S2 |
| Molecular Weight | 574.62 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(3-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | O=C(C=Cc1ccccc1)C1=C(O)C(=O)N(c2nnc(SCc3ccc(F)cc3)s2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H19FN4O5S2/c29-20-12-9-18(10-13-20)16-39-28-31-30-27(40-28)32-24(19-7-4-8-21(15-19)33(37)38)23(25(35)26(32)36)22(34)14-11-17-5-2-1-3-6-17/h1-15,24,35H,16H2 |
| InChIKey | DPWYDMDMFSKJOE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|