C35H34FN3O5S2 — CID 4696636
2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4696636) has the molecular formula C35H34FN3O5S2 and a molecular weight of 659.81 g/mol. Its IUPAC name is 2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696636 |
| Molecular Formula | C35H34FN3O5S2 |
| Molecular Weight | 659.81 g/mol |
| Exact Mass | 659.19 |
| IUPAC Name | 2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | CCOc1cc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2c2nnc(SCc3ccc(F)cc3)s2)ccc1OCCC(C)C |
| InChI | InChI=1S/C35H34FN3O5S2/c1-4-43-29-20-25(13-17-28(29)44-19-18-22(2)3)31-30(27(40)16-12-23-8-6-5-7-9-23)32(41)33(42)39(31)34-37-38-35(46-34)45-21-24-10-14-26(36)15-11-24/h5-17,20,22,31,41H,4,18-19,21H2,1-3H3 |
| InChIKey | MKMINPKNHZUPGN-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.81 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|