C34H32ClN3O5S2 — CID 4696511
1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4696511) has the molecular formula C34H32ClN3O5S2 and a molecular weight of 662.23 g/mol. Its IUPAC name is 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696511 |
| Molecular Formula | C34H32ClN3O5S2 |
| Molecular Weight | 662.23 g/mol |
| Exact Mass | 661.15 |
| IUPAC Name | 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | COc1cc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3)s2)ccc1OCCC(C)C |
| InChI | InChI=1S/C34H32ClN3O5S2/c1-21(2)17-18-43-27-16-12-24(19-28(27)42-3)30-29(26(39)15-11-22-7-5-4-6-8-22)31(40)32(41)38(30)33-36-37-34(45-33)44-20-23-9-13-25(35)14-10-23/h4-16,19,21,30,40H,17-18,20H2,1-3H3 |
| InChIKey | AFNNVIGJYFTLGD-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.23 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|