C27H23N3O4S3 — CID 3252386
1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-propoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3252386) has the molecular formula C27H23N3O4S3 and a molecular weight of 549.70 g/mol. Its IUPAC name is 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-propoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-propoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3252386 |
| Molecular Formula | C27H23N3O4S3 |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-propoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCOc1cccc(C2C(C(=O)c3cccs3)=C(O)C(=O)N2c2nnc(SCc3ccccc3)s2)c1 |
| InChI | InChI=1S/C27H23N3O4S3/c1-2-13-34-19-11-6-10-18(15-19)22-21(23(31)20-12-7-14-35-20)24(32)25(33)30(22)26-28-29-27(37-26)36-16-17-8-4-3-5-9-17/h3-12,14-15,22,32H,2,13,16H2,1H3 |
| InChIKey | DISKJYRILPTNQO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|