C29H26FN3O4S3 — CID 3370341
1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(3-pentoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3370341) has the molecular formula C29H26FN3O4S3 and a molecular weight of 595.74 g/mol. Its IUPAC name is 1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(3-pentoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(3-pentoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3370341 |
| Molecular Formula | C29H26FN3O4S3 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | 1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(3-pentoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCCOc1cccc(C2C(C(=O)c3cccs3)=C(O)C(=O)N2c2nnc(SCc3ccccc3F)s2)c1 |
| InChI | InChI=1S/C29H26FN3O4S3/c1-2-3-6-14-37-20-11-7-10-18(16-20)24-23(25(34)22-13-8-15-38-22)26(35)27(36)33(24)28-31-32-29(40-28)39-17-19-9-4-5-12-21(19)30/h4-5,7-13,15-16,24,35H,2-3,6,14,17H2,1H3 |
| InChIKey | KMRDOTKUPROIHM-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|