C31H31N3O5S3 — CID 3380924
1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3380924) has the molecular formula C31H31N3O5S3 and a molecular weight of 621.81 g/mol. Its IUPAC name is 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3380924 |
| Molecular Formula | C31H31N3O5S3 |
| Molecular Weight | 621.81 g/mol |
| Exact Mass | 621.14 |
| IUPAC Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)c3cccs3)=C(O)C(=O)N2c2nnc(SCc3ccccc3)s2)cc1OCC |
| InChI | InChI=1S/C31H31N3O5S3/c1-3-5-9-16-39-22-15-14-21(18-23(22)38-4-2)26-25(27(35)24-13-10-17-40-24)28(36)29(37)34(26)30-32-33-31(42-30)41-19-20-11-7-6-8-12-20/h6-8,10-15,17-18,26,36H,3-5,9,16,19H2,1-2H3 |
| InChIKey | MTKLZGZHUPEGIB-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.81 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|