C24H24N2O5S2 — CID 3379279
2-(4-butoxy-3-ethoxyphenyl)-4-hydroxy-1-(1,3-thiazol-2-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3379279) has the molecular formula C24H24N2O5S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-(4-butoxy-3-ethoxyphenyl)-4-hydroxy-1-(1,3-thiazol-2-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-ethoxyphenyl)-4-hydroxy-1-(1,3-thiazol-2-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3379279 |
| Molecular Formula | C24H24N2O5S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2-(4-butoxy-3-ethoxyphenyl)-4-hydroxy-1-(1,3-thiazol-2-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3cccs3)=C(O)C(=O)N2c2nccs2)cc1OCC |
| InChI | InChI=1S/C24H24N2O5S2/c1-3-5-11-31-16-9-8-15(14-17(16)30-4-2)20-19(21(27)18-7-6-12-32-18)22(28)23(29)26(20)24-25-10-13-33-24/h6-10,12-14,20,28H,3-5,11H2,1-2H3 |
| InChIKey | KTQCQEWYLCMMKV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|