C30H32N2O7S2 — CID 3380828
prop-2-enyl 2-[2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 3380828) has the molecular formula C30H32N2O7S2 and a molecular weight of 596.73 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3380828 |
| Molecular Formula | C30H32N2O7S2 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | prop-2-enyl 2-[2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(O)=C(C(=O)c3cccs3)C2c2ccc(OCCCCC)c(OCC)c2)nc1C |
| InChI | InChI=1S/C30H32N2O7S2/c1-5-8-9-15-38-20-13-12-19(17-21(20)37-7-3)24-23(25(33)22-11-10-16-40-22)26(34)28(35)32(24)30-31-18(4)27(41-30)29(36)39-14-6-2/h6,10-13,16-17,24,34H,2,5,7-9,14-15H2,1,3-4H3 |
| InChIKey | XFNYVJUEPXZXAW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|