C32H33N3O5S3 — CID 3380925
2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3380925) has the molecular formula C32H33N3O5S3 and a molecular weight of 635.83 g/mol. Its IUPAC name is 2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3380925 |
| Molecular Formula | C32H33N3O5S3 |
| Molecular Weight | 635.83 g/mol |
| Exact Mass | 635.16 |
| IUPAC Name | 2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)c3cccs3)=C(O)C(=O)N2c2nnc(SCc3ccc(C)cc3)s2)cc1OCC |
| InChI | InChI=1S/C32H33N3O5S3/c1-4-6-7-16-40-23-15-14-22(18-24(23)39-5-2)27-26(28(36)25-9-8-17-41-25)29(37)30(38)35(27)31-33-34-32(43-31)42-19-21-12-10-20(3)11-13-21/h8-15,17-18,27,37H,4-7,16,19H2,1-3H3 |
| InChIKey | AXIVPGPLRGHPQZ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.83 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|