C31H31N3O6S2 — CID 18813581
1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-methoxy-4-pentoxyphenyl)-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 18813581) has the molecular formula C31H31N3O6S2 and a molecular weight of 605.74 g/mol. Its IUPAC name is 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-methoxy-4-pentoxyphenyl)-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-methoxy-4-pentoxyphenyl)-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 18813581 |
| Molecular Formula | C31H31N3O6S2 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-methoxy-4-pentoxyphenyl)-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)c3ccc(C)o3)=C(O)C(=O)N2c2nnc(SCc3ccccc3)s2)cc1OC |
| InChI | InChI=1S/C31H31N3O6S2/c1-4-5-9-16-39-22-15-13-21(17-24(22)38-3)26-25(27(35)23-14-12-19(2)40-23)28(36)29(37)34(26)30-32-33-31(42-30)41-18-20-10-7-6-8-11-20/h6-8,10-15,17,26,36H,4-5,9,16,18H2,1-3H3 |
| InChIKey | OZLYBSTWFLRJMA-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|