C30H28ClN3O6S2 — CID 18814490
2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 18814490) has the molecular formula C30H28ClN3O6S2 and a molecular weight of 626.16 g/mol. Its IUPAC name is 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 18814490 |
| Molecular Formula | C30H28ClN3O6S2 |
| Molecular Weight | 626.16 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3ccc(C)o3)=C(O)C(=O)N2c2nnc(SCc3ccccc3Cl)s2)cc1OC |
| InChI | InChI=1S/C30H28ClN3O6S2/c1-4-5-14-39-21-13-11-18(15-23(21)38-3)25-24(26(35)22-12-10-17(2)40-22)27(36)28(37)34(25)29-32-33-30(42-29)41-16-19-8-6-7-9-20(19)31/h6-13,15,25,36H,4-5,14,16H2,1-3H3 |
| InChIKey | VDESXPSQPPACLF-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.16 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|