C35H32ClN3O7S2 — CID 4866030
2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 4866030) has the molecular formula C35H32ClN3O7S2 and a molecular weight of 706.24 g/mol. Its IUPAC name is 2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4866030 |
| Molecular Formula | C35H32ClN3O7S2 |
| Molecular Weight | 706.24 g/mol |
| Exact Mass | 705.14 |
| IUPAC Name | 2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3cc4cccc(OC)c4o3)=C(O)C(=O)N2c2nnc(SCc3ccccc3Cl)s2)cc1OCC |
| InChI | InChI=1S/C35H32ClN3O7S2/c1-4-6-16-45-24-15-14-20(17-26(24)44-5-2)29-28(30(40)27-18-21-11-9-13-25(43-3)32(21)46-27)31(41)33(42)39(29)34-37-38-35(48-34)47-19-22-10-7-8-12-23(22)36/h7-15,17-18,29,41H,4-6,16,19H2,1-3H3 |
| InChIKey | OZJBEIATRHPYLD-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.24 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|