C34H30ClN3O6S2 — CID 4866024
1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-pentoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4866024) has the molecular formula C34H30ClN3O6S2 and a molecular weight of 676.22 g/mol. Its IUPAC name is 1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-pentoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-pentoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4866024 |
| Molecular Formula | C34H30ClN3O6S2 |
| Molecular Weight | 676.22 g/mol |
| Exact Mass | 675.13 |
| IUPAC Name | 1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-pentoxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCCCCOc1cccc(C2C(C(=O)c3cc4cccc(OC)c4o3)=C(O)C(=O)N2c2nnc(SCc3ccccc3Cl)s2)c1 |
| InChI | InChI=1S/C34H30ClN3O6S2/c1-3-4-7-16-43-23-13-8-11-20(17-23)28-27(29(39)26-18-21-12-9-15-25(42-2)31(21)44-26)30(40)32(41)38(28)33-36-37-34(46-33)45-19-22-10-5-6-14-24(22)35/h5-6,8-15,17-18,28,40H,3-4,7,16,19H2,1-2H3 |
| InChIKey | ZDNGAVPAEZXIMQ-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.22 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|