C34H29Cl2N3O7S2 — CID 5259348
2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 5259348) has the molecular formula C34H29Cl2N3O7S2 and a molecular weight of 726.66 g/mol. Its IUPAC name is 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 5259348 |
| Molecular Formula | C34H29Cl2N3O7S2 |
| Molecular Weight | 726.66 g/mol |
| Exact Mass | 725.08 |
| IUPAC Name | 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3cc4cccc(OC)c4o3)=C(O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3Cl)s2)cc1OC |
| InChI | InChI=1S/C34H29Cl2N3O7S2/c1-4-5-13-45-23-12-10-18(14-25(23)44-3)28-27(29(40)26-15-19-7-6-8-24(43-2)31(19)46-26)30(41)32(42)39(28)33-37-38-34(48-33)47-17-20-9-11-21(35)16-22(20)36/h6-12,14-16,28,41H,4-5,13,17H2,1-3H3 |
| InChIKey | BGDPMBLHHOETSQ-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.66 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|