C30H28Cl2N4O5S3 — CID 4734368
2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 4734368) has the molecular formula C30H28Cl2N4O5S3 and a molecular weight of 691.68 g/mol. Its IUPAC name is 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4734368 |
| Molecular Formula | C30H28Cl2N4O5S3 |
| Molecular Weight | 691.68 g/mol |
| Exact Mass | 690.06 |
| IUPAC Name | 2-(4-butoxy-3-methoxyphenyl)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3sc(C)nc3C)=C(O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3Cl)s2)cc1OC |
| InChI | InChI=1S/C30H28Cl2N4O5S3/c1-5-6-11-41-21-10-8-17(12-22(21)40-4)24-23(25(37)27-15(2)33-16(3)43-27)26(38)28(39)36(24)29-34-35-30(44-29)42-14-18-7-9-19(31)13-20(18)32/h7-10,12-13,24,38H,5-6,11,14H2,1-4H3 |
| InChIKey | UAILGTADIDQXAV-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.68 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|