C31H31ClN4O5S3 — CID 4734058
2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 4734058) has the molecular formula C31H31ClN4O5S3 and a molecular weight of 671.27 g/mol. Its IUPAC name is 2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4734058 |
| Molecular Formula | C31H31ClN4O5S3 |
| Molecular Weight | 671.27 g/mol |
| Exact Mass | 670.11 |
| IUPAC Name | 2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3sc(C)nc3C)=C(O)C(=O)N2c2nnc(SCc3ccccc3Cl)s2)cc1OCC |
| InChI | InChI=1S/C31H31ClN4O5S3/c1-5-7-14-41-22-13-12-19(15-23(22)40-6-2)25-24(26(37)28-17(3)33-18(4)43-28)27(38)29(39)36(25)30-34-35-31(44-30)42-16-20-10-8-9-11-21(20)32/h8-13,15,25,38H,5-7,14,16H2,1-4H3 |
| InChIKey | IOYHHVOXBOHRJC-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.27 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|