C31H30ClN3O6S2 — CID 3427946
2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3427946) has the molecular formula C31H30ClN3O6S2 and a molecular weight of 640.18 g/mol. Its IUPAC name is 2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3427946 |
| Molecular Formula | C31H30ClN3O6S2 |
| Molecular Weight | 640.18 g/mol |
| Exact Mass | 639.13 |
| IUPAC Name | 2-(4-butoxy-3-ethoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3ccc(C)o3)=C(O)C(=O)N2c2nnc(SCc3ccccc3Cl)s2)cc1OCC |
| InChI | InChI=1S/C31H30ClN3O6S2/c1-4-6-15-40-22-14-12-19(16-24(22)39-5-2)26-25(27(36)23-13-11-18(3)41-23)28(37)29(38)35(26)30-33-34-31(43-30)42-17-20-9-7-8-10-21(20)32/h7-14,16,26,37H,4-6,15,17H2,1-3H3 |
| InChIKey | KDKYDPQIZDVUMI-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.18 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|