C28H24ClN3O5S2 — CID 18814451
2-(4-butoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 18814451) has the molecular formula C28H24ClN3O5S2 and a molecular weight of 582.10 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 18814451 |
| Molecular Formula | C28H24ClN3O5S2 |
| Molecular Weight | 582.10 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | 2-(4-butoxyphenyl)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3ccco3)=C(O)C(=O)N2c2nnc(SCc3ccccc3Cl)s2)cc1 |
| InChI | InChI=1S/C28H24ClN3O5S2/c1-2-3-14-36-19-12-10-17(11-13-19)23-22(24(33)21-9-6-15-37-21)25(34)26(35)32(23)27-30-31-28(39-27)38-16-18-7-4-5-8-20(18)29/h4-13,15,23,34H,2-3,14,16H2,1H3 |
| InChIKey | CWDHDOQROIWWJI-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.10 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|