C24H17N3O4S2 — CID 40969311
(2S)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one (PubChem CID 40969311) has the molecular formula C24H17N3O4S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is (2S)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one.
| Compound Name | (2S)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 40969311 |
| Molecular Formula | C24H17N3O4S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | (2S)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2nnc(SCc3ccccc3)s2)[C@H]1c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C24H17N3O4S2/c28-20(17-12-7-13-31-17)18-19(16-10-5-2-6-11-16)27(22(30)21(18)29)23-25-26-24(33-23)32-14-15-8-3-1-4-9-15/h1-13,19,29H,14H2/t19-/m0/s1 |
| InChIKey | NZCAUOPDWPEZNW-IBGZPJMESA-N |
| XLogP | 5.21 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|