C27H20ClN3O5S2 — CID 3385074
1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one (PubChem CID 3385074) has the molecular formula C27H20ClN3O5S2 and a molecular weight of 566.06 g/mol. Its IUPAC name is 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3385074 |
| Molecular Formula | C27H20ClN3O5S2 |
| Molecular Weight | 566.06 g/mol |
| Exact Mass | 565.05 |
| IUPAC Name | 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
| SMILES | C=CCOc1cccc(C2C(C(=O)c3ccco3)=C(O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3)s2)c1 |
| InChI | InChI=1S/C27H20ClN3O5S2/c1-2-12-35-19-6-3-5-17(14-19)22-21(23(32)20-7-4-13-36-20)24(33)25(34)31(22)26-29-30-27(38-26)37-15-16-8-10-18(28)11-9-16/h2-11,13-14,22,33H,1,12,15H2 |
| InChIKey | LLSCQOGOSJRVSV-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.06 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|