C24H15ClN4O6S2 — CID 18814884
1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 18814884) has the molecular formula C24H15ClN4O6S2 and a molecular weight of 554.99 g/mol. Its IUPAC name is 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 18814884 |
| Molecular Formula | C24H15ClN4O6S2 |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.01 |
| IUPAC Name | 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2nnc(SCc3ccc(Cl)cc3)s2)C1c1ccc([N+](=O)[O-])cc1)c1ccco1 |
| InChI | InChI=1S/C24H15ClN4O6S2/c25-15-7-3-13(4-8-15)12-36-24-27-26-23(37-24)28-19(14-5-9-16(10-6-14)29(33)34)18(21(31)22(28)32)20(30)17-2-1-11-35-17/h1-11,19,31H,12H2 |
| InChIKey | NMLVSLOVGCGHJX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|