C24H14Cl2N4O6S2 — CID 18816229
1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 18816229) has the molecular formula C24H14Cl2N4O6S2 and a molecular weight of 589.44 g/mol. Its IUPAC name is 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 18816229 |
| Molecular Formula | C24H14Cl2N4O6S2 |
| Molecular Weight | 589.44 g/mol |
| Exact Mass | 587.97 |
| IUPAC Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2nnc(SCc3ccc(Cl)cc3Cl)s2)C1c1ccc([N+](=O)[O-])cc1)c1ccco1 |
| InChI | InChI=1S/C24H14Cl2N4O6S2/c25-14-6-3-13(16(26)10-14)11-37-24-28-27-23(38-24)29-19(12-4-7-15(8-5-12)30(34)35)18(21(32)22(29)33)20(31)17-2-1-9-36-17/h1-10,19,32H,11H2 |
| InChIKey | XBEZBCWPKJXUEN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.44 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|