C29H18Cl2N4O7S2 — CID 5245250
1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 5245250) has the molecular formula C29H18Cl2N4O7S2 and a molecular weight of 669.52 g/mol. Its IUPAC name is 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 5245250 |
| Molecular Formula | C29H18Cl2N4O7S2 |
| Molecular Weight | 669.52 g/mol |
| Exact Mass | 668.00 |
| IUPAC Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | COc1cccc2cc(C(=O)C3=C(O)C(=O)N(c4nnc(SCc5ccc(Cl)cc5Cl)s4)C3c3cccc([N+](=O)[O-])c3)oc12 |
| InChI | InChI=1S/C29H18Cl2N4O7S2/c1-41-20-7-3-5-15-11-21(42-26(15)20)24(36)22-23(14-4-2-6-18(10-14)35(39)40)34(27(38)25(22)37)28-32-33-29(44-28)43-13-16-8-9-17(30)12-19(16)31/h2-12,23,37H,13H2,1H3 |
| InChIKey | WZPJXCBDZYYFIM-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.52 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|