C32H23Cl2N3O6S2 — CID 5259345
1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one (PubChem CID 5259345) has the molecular formula C32H23Cl2N3O6S2 and a molecular weight of 680.59 g/mol. Its IUPAC name is 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 5259345 |
| Molecular Formula | C32H23Cl2N3O6S2 |
| Molecular Weight | 680.59 g/mol |
| Exact Mass | 679.04 |
| IUPAC Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
| SMILES | C=CCOc1ccc(C2C(C(=O)c3cc4cccc(OC)c4o3)=C(O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3Cl)s2)cc1 |
| InChI | InChI=1S/C32H23Cl2N3O6S2/c1-3-13-42-21-11-8-17(9-12-21)26-25(27(38)24-14-18-5-4-6-23(41-2)29(18)43-24)28(39)30(40)37(26)31-35-36-32(45-31)44-16-19-7-10-20(33)15-22(19)34/h3-12,14-15,26,39H,1,13,16H2,2H3 |
| InChIKey | HCEULKRLWLRCMY-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.59 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|