C25H17FN2O5S — CID 3385795
1-(6-fluoro-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one (PubChem CID 3385795) has the molecular formula C25H17FN2O5S and a molecular weight of 476.49 g/mol. Its IUPAC name is 1-(6-fluoro-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-(6-fluoro-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3385795 |
| Molecular Formula | C25H17FN2O5S |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 1-(6-fluoro-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
| SMILES | C=CCOc1cccc(C2C(C(=O)c3ccco3)=C(O)C(=O)N2c2nc3ccc(F)cc3s2)c1 |
| InChI | InChI=1S/C25H17FN2O5S/c1-2-10-32-16-6-3-5-14(12-16)21-20(22(29)18-7-4-11-33-18)23(30)24(31)28(21)25-27-17-9-8-15(26)13-19(17)34-25/h2-9,11-13,21,30H,1,10H2 |
| InChIKey | XFZKKXSZSVUTKE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|