C33H36N4O5S3 — CID 4733977
3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2H-pyrrol-5-one (PubChem CID 4733977) has the molecular formula C33H36N4O5S3 and a molecular weight of 664.88 g/mol. Its IUPAC name is 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2H-pyrrol-5-one.
| Compound Name | 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4733977 |
| Molecular Formula | C33H36N4O5S3 |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.18 |
| IUPAC Name | 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)c3sc(C)nc3C)=C(O)C(=O)N2c2nnc(SCc3ccc(C)cc3)s2)cc1OCC |
| InChI | InChI=1S/C33H36N4O5S3/c1-6-8-9-16-42-24-15-14-23(17-25(24)41-7-2)27-26(28(38)30-20(4)34-21(5)44-30)29(39)31(40)37(27)32-35-36-33(45-32)43-18-22-12-10-19(3)11-13-22/h10-15,17,27,39H,6-9,16,18H2,1-5H3 |
| InChIKey | YAGYEMSUVRNSDG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|