C29H27FN4O4S3 — CID 4734338
2-(2-butoxyphenyl)-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2H-pyrrol-5-one (PubChem CID 4734338) has the molecular formula C29H27FN4O4S3 and a molecular weight of 610.76 g/mol. Its IUPAC name is 2-(2-butoxyphenyl)-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 2-(2-butoxyphenyl)-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4734338 |
| Molecular Formula | C29H27FN4O4S3 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | 2-(2-butoxyphenyl)-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccccc1C1C(C(=O)c2sc(C)nc2C)=C(O)C(=O)N1c1nnc(SCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C29H27FN4O4S3/c1-4-5-14-38-21-9-7-6-8-20(21)23-22(24(35)26-16(2)31-17(3)40-26)25(36)27(37)34(23)28-32-33-29(41-28)39-15-18-10-12-19(30)13-11-18/h6-13,23,36H,4-5,14-15H2,1-3H3 |
| InChIKey | GJPBGHGCTMHBTK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|