C28H38N2O5S — CID 3380825
1-[2-(diethylamino)ethyl]-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3380825) has the molecular formula C28H38N2O5S and a molecular weight of 514.69 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-[2-(diethylamino)ethyl]-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3380825 |
| Molecular Formula | C28H38N2O5S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)c3cccs3)=C(O)C(=O)N2CCN(CC)CC)cc1OCC |
| InChI | InChI=1S/C28H38N2O5S/c1-5-9-10-17-35-21-14-13-20(19-22(21)34-8-4)25-24(26(31)23-12-11-18-36-23)27(32)28(33)30(25)16-15-29(6-2)7-3/h11-14,18-19,25,32H,5-10,15-17H2,1-4H3 |
| InChIKey | XCYBWILRPSUDBJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|