C30H26N2O5S — CID 4696812
4-hydroxy-1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2-(4-propoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4696812) has the molecular formula C30H26N2O5S and a molecular weight of 526.61 g/mol. Its IUPAC name is 4-hydroxy-1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2-(4-propoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2-(4-propoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696812 |
| Molecular Formula | C30H26N2O5S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 4-hydroxy-1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2-(4-propoxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCCOc1ccc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C30H26N2O5S/c1-3-17-37-21-12-10-20(11-13-21)27-26(24(33)16-9-19-7-5-4-6-8-19)28(34)29(35)32(27)30-31-23-15-14-22(36-2)18-25(23)38-30/h4-16,18,27,34H,3,17H2,1-2H3 |
| InChIKey | QAJFLSLBATUULH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|