C34H34N2O6S — CID 4696838
2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4696838) has the molecular formula C34H34N2O6S and a molecular weight of 598.72 g/mol. Its IUPAC name is 2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696838 |
| Molecular Formula | C34H34N2O6S |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 2-(3-ethoxy-4-pentoxyphenyl)-4-hydroxy-1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2c2nc3ccc(OC)cc3s2)cc1OCC |
| InChI | InChI=1S/C34H34N2O6S/c1-4-6-10-19-42-27-18-14-23(20-28(27)41-5-2)31-30(26(37)17-13-22-11-8-7-9-12-22)32(38)33(39)36(31)34-35-25-16-15-24(40-3)21-29(25)43-34/h7-9,11-18,20-21,31,38H,4-6,10,19H2,1-3H3 |
| InChIKey | LWVOHDWGJSAZCW-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|