C28H20Cl2N2O4S — CID 6189593
2-(3,4-dichlorophenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189593) has the molecular formula C28H20Cl2N2O4S and a molecular weight of 551.45 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189593 |
| Molecular Formula | C28H20Cl2N2O4S |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | CCOc1ccc2nc(N3C(=O)C(O)=C(C(=O)/C=C/c4ccccc4)C3c3ccc(Cl)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C28H20Cl2N2O4S/c1-2-36-18-10-12-21-23(15-18)37-28(31-21)32-25(17-9-11-19(29)20(30)14-17)24(26(34)27(32)35)22(33)13-8-16-6-4-3-5-7-16/h3-15,25,34H,2H2,1H3/b13-8+ |
| InChIKey | NSIWVBKGTZEYRT-MDWZMJQESA-N |
| XLogP | 7.18 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|