C29H24N2O4S — CID 6189588
1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-2-(4-methylphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189588) has the molecular formula C29H24N2O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is 1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-2-(4-methylphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-2-(4-methylphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189588 |
| Molecular Formula | C29H24N2O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-2-(4-methylphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | CCOc1ccc2nc(N3C(=O)C(O)=C(C(=O)/C=C/c4ccccc4)C3c3ccc(C)cc3)sc2c1 |
| InChI | InChI=1S/C29H24N2O4S/c1-3-35-21-14-15-22-24(17-21)36-29(30-22)31-26(20-12-9-18(2)10-13-20)25(27(33)28(31)34)23(32)16-11-19-7-5-4-6-8-19/h4-17,26,33H,3H2,1-2H3/b16-11+ |
| InChIKey | BSMDBZHREQMJPB-LFIBNONCSA-N |
| XLogP | 6.19 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|