C32H30N2O4S — CID 6189726
4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-2-(3-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189726) has the molecular formula C32H30N2O4S and a molecular weight of 538.67 g/mol. Its IUPAC name is 4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-2-(3-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-2-(3-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189726 |
| Molecular Formula | C32H30N2O4S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-2-(3-pentoxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | CCCCCOc1cccc(C2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2c2nc3ccc(C)cc3s2)c1 |
| InChI | InChI=1S/C32H30N2O4S/c1-3-4-8-18-38-24-13-9-12-23(20-24)29-28(26(35)17-15-22-10-6-5-7-11-22)30(36)31(37)34(29)32-33-25-16-14-21(2)19-27(25)39-32/h5-7,9-17,19-20,29,36H,3-4,8,18H2,1-2H3/b17-15+ |
| InChIKey | WTNNOZXSDMZTSZ-BMRADRMJSA-N |
| XLogP | 7.36 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|